C16H15NS2 — CID 14762301
2-[4-(ethylsulfanylmethyl)phenyl]-1,3-benzothiazole (PubChem CID 14762301) has the molecular formula C16H15NS2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-[4-(ethylsulfanylmethyl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-(ethylsulfanylmethyl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 14762301 |
| Molecular Formula | C16H15NS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[4-(ethylsulfanylmethyl)phenyl]-1,3-benzothiazole |
| SMILES | CCSCc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H15NS2/c1-2-18-11-12-7-9-13(10-8-12)16-17-14-5-3-4-6-15(14)19-16/h3-10H,2,11H2,1H3 |
| InChIKey | ATHKSAOYPRYHDO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |