C17H18N2O2S2 — CID 3582989
4-(1,3-benzothiazol-2-yl)-N,N-diethylbenzenesulfonamide (PubChem CID 3582989) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3582989 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H18N2O2S2/c1-3-19(4-2)23(20,21)14-11-9-13(10-12-14)17-18-15-7-5-6-8-16(15)22-17/h5-12H,3-4H2,1-2H3 |
| InChIKey | FTFJHBOKQIMIBP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |