C19H16N4O2S2 — CID 2316500
4-(1,3-benzothiazol-2-yl)-N,N-bis(2-cyanoethyl)benzenesulfonamide (PubChem CID 2316500) has the molecular formula C19H16N4O2S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N,N-bis(2-cyanoethyl)benzenesulfonamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N,N-bis(2-cyanoethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2316500 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N,N-bis(2-cyanoethyl)benzenesulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H16N4O2S2/c20-11-3-13-23(14-4-12-21)27(24,25)16-9-7-15(8-10-16)19-22-17-5-1-2-6-18(17)26-19/h1-2,5-10H,3-4,13-14H2 |
| InChIKey | AWOYWMQESODUTR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |