C17H23N3O2S — CID 3801620
N,N-bis(2-cyanoethyl)-4-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 3801620) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-4-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | N,N-bis(2-cyanoethyl)-4-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3801620 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-4-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)N(CCC#N)CCC#N)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-17(2,3)15-7-9-16(10-8-15)23(21,22)20(13-5-11-18)14-6-12-19/h7-10H,4-6,13-14H2,1-3H3 |
| InChIKey | YSHCOOUSZXVOAZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |