C13H15F3N2O2S — CID 51109256
N-(2-cyanoethyl)-N-propan-2-yl-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 51109256) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-propan-2-yl-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-propan-2-yl-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 51109256 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(2-cyanoethyl)-N-propan-2-yl-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)N(CCC#N)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2O2S/c1-10(2)18(9-3-8-17)21(19,20)12-6-4-11(5-7-12)13(14,15)16/h4-7,10H,3,9H2,1-2H3 |
| InChIKey | GMXUZLWYQJYTSZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |