C11H13FN2O4S2 — CID 114791502
4-[2-cyanoethyl(ethyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114791502) has the molecular formula C11H13FN2O4S2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-[2-cyanoethyl(ethyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[2-cyanoethyl(ethyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114791502 |
| Molecular Formula | C11H13FN2O4S2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-[2-cyanoethyl(ethyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CCN(CCC#N)S(=O)(=O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C11H13FN2O4S2/c1-2-14(9-3-8-13)20(17,18)11-6-4-10(5-7-11)19(12,15)16/h4-7H,2-3,9H2,1H3 |
| InChIKey | GGUOZDFCMLMOBM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |