C13H20FNO4S2 — CID 114791690
4-[ethyl(2-methylbutyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114791690) has the molecular formula C13H20FNO4S2 and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-[ethyl(2-methylbutyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[ethyl(2-methylbutyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114791690 |
| Molecular Formula | C13H20FNO4S2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[ethyl(2-methylbutyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CCC(C)CN(CC)S(=O)(=O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C13H20FNO4S2/c1-4-11(3)10-15(5-2)21(18,19)13-8-6-12(7-9-13)20(14,16)17/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | PBOQTVMSLZERHG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |