C12H22N4O2S — CID 79469996
N-ethyl-6-hydrazinyl-N-(2-methylbutyl)pyridine-3-sulfonamide (PubChem CID 79469996) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-ethyl-6-hydrazinyl-N-(2-methylbutyl)pyridine-3-sulfonamide.
| Compound Name | N-ethyl-6-hydrazinyl-N-(2-methylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 79469996 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-ethyl-6-hydrazinyl-N-(2-methylbutyl)pyridine-3-sulfonamide |
| SMILES | CCC(C)CN(CC)S(=O)(=O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C12H22N4O2S/c1-4-10(3)9-16(5-2)19(17,18)11-6-7-12(15-13)14-8-11/h6-8,10H,4-5,9,13H2,1-3H3,(H,14,15) |
| InChIKey | RGSFBUAAMCPIGR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|