C11H19N3O2S — CID 113250552
6-(butan-2-ylamino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 113250552) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 6-(butan-2-ylamino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(butan-2-ylamino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113250552 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-(butan-2-ylamino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CCC(C)Nc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C11H19N3O2S/c1-5-9(2)13-11-7-6-10(8-12-11)17(15,16)14(3)4/h6-9H,5H2,1-4H3,(H,12,13) |
| InChIKey | JVGNUSMUBDZHSM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |