C15H27N3O2S — CID 103340977
N,N-dimethyl-6-(6-methylheptan-2-ylamino)pyridine-3-sulfonamide (PubChem CID 103340977) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N,N-dimethyl-6-(6-methylheptan-2-ylamino)pyridine-3-sulfonamide.
| Compound Name | N,N-dimethyl-6-(6-methylheptan-2-ylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103340977 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N,N-dimethyl-6-(6-methylheptan-2-ylamino)pyridine-3-sulfonamide |
| SMILES | CC(C)CCCC(C)Nc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C15H27N3O2S/c1-12(2)7-6-8-13(3)17-15-10-9-14(11-16-15)21(19,20)18(4)5/h9-13H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | DQUKBPZFZDMYFA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |