C10H18N4O2S — CID 103341130
6-(2-aminopropylamino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 103341130) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 6-(2-aminopropylamino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(2-aminopropylamino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103341130 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 6-(2-aminopropylamino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CC(N)CNc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C10H18N4O2S/c1-8(11)6-12-10-5-4-9(7-13-10)17(15,16)14(2)3/h4-5,7-8H,6,11H2,1-3H3,(H,12,13) |
| InChIKey | GWNJJLDLSOLLAG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |