C11H19N3O4S — CID 107389803
6-(2,2-dimethoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 107389803) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is 6-(2,2-dimethoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(2,2-dimethoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107389803 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 6-(2,2-dimethoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | COC(CNc1ccc(S(=O)(=O)N(C)C)cn1)OC |
| InChI | InChI=1S/C11H19N3O4S/c1-14(2)19(15,16)9-5-6-10(12-7-9)13-8-11(17-3)18-4/h5-7,11H,8H2,1-4H3,(H,12,13) |
| InChIKey | NBHLGLMFAOEHHL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|