C14H26N4O2S — CID 106048482
N,N-dimethyl-6-[3-[methyl(propan-2-yl)amino]propylamino]pyridine-3-sulfonamide (PubChem CID 106048482) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is N,N-dimethyl-6-[3-[methyl(propan-2-yl)amino]propylamino]pyridine-3-sulfonamide.
| Compound Name | N,N-dimethyl-6-[3-[methyl(propan-2-yl)amino]propylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106048482 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N,N-dimethyl-6-[3-[methyl(propan-2-yl)amino]propylamino]pyridine-3-sulfonamide |
| SMILES | CC(C)N(C)CCCNc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C14H26N4O2S/c1-12(2)18(5)10-6-9-15-14-8-7-13(11-16-14)21(19,20)17(3)4/h7-8,11-12H,6,9-10H2,1-5H3,(H,15,16) |
| InChIKey | CNRJEIYGQWZZQW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|