C14H26N4O2S — CID 103340951
6-[3-(diethylamino)propylamino]-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 103340951) has the molecular formula C14H26N4O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 6-[3-(diethylamino)propylamino]-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-[3-(diethylamino)propylamino]-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103340951 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 6-[3-(diethylamino)propylamino]-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CCN(CC)CCCNc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C14H26N4O2S/c1-5-18(6-2)11-7-10-15-14-9-8-13(12-16-14)21(19,20)17(3)4/h8-9,12H,5-7,10-11H2,1-4H3,(H,15,16) |
| InChIKey | KEECDYOYLXUFLW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|