C11H20N4O4S2 — CID 106338159
6-[2-(ethylsulfamoyl)ethylamino]-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 106338159) has the molecular formula C11H20N4O4S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-[2-(ethylsulfamoyl)ethylamino]-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-[2-(ethylsulfamoyl)ethylamino]-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106338159 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 6-[2-(ethylsulfamoyl)ethylamino]-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C11H20N4O4S2/c1-4-14-20(16,17)8-7-12-11-6-5-10(9-13-11)21(18,19)15(2)3/h5-6,9,14H,4,7-8H2,1-3H3,(H,12,13) |
| InChIKey | VGDZDQGXKLLAPK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |