C12H21N3O3S — CID 104577001
N,N-dimethyl-6-(2-propan-2-yloxyethylamino)pyridine-3-sulfonamide (PubChem CID 104577001) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is N,N-dimethyl-6-(2-propan-2-yloxyethylamino)pyridine-3-sulfonamide.
| Compound Name | N,N-dimethyl-6-(2-propan-2-yloxyethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104577001 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N,N-dimethyl-6-(2-propan-2-yloxyethylamino)pyridine-3-sulfonamide |
| SMILES | CC(C)OCCNc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C12H21N3O3S/c1-10(2)18-8-7-13-12-6-5-11(9-14-12)19(16,17)15(3)4/h5-6,9-10H,7-8H2,1-4H3,(H,13,14) |
| InChIKey | JTKALFHFSXCRKG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|