C13H21N3O3S — CID 103853630
6-(2-but-3-enoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 103853630) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 6-(2-but-3-enoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(2-but-3-enoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103853630 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-(2-but-3-enoxyethylamino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | C=CCCOCCNc1ccc(S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C13H21N3O3S/c1-4-5-9-19-10-8-14-13-7-6-12(11-15-13)20(17,18)16(2)3/h4,6-7,11H,1,5,8-10H2,2-3H3,(H,14,15) |
| InChIKey | QOJBROUYMMVVAC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|