C14H21F3N2 — CID 63539653
N-(6-methylheptan-2-yl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 63539653) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(6-methylheptan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63539653 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(6-methylheptan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)CCCC(C)Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H21F3N2/c1-10(2)5-4-6-11(3)19-13-8-7-12(9-18-13)14(15,16)17/h7-11H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | UDTCMGQSEAQDNX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |