C13H21N3O2S — CID 103850302
6-(1-cyclobutylethylamino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 103850302) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 6-(1-cyclobutylethylamino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(1-cyclobutylethylamino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103850302 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 6-(1-cyclobutylethylamino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CC(Nc1ccc(S(=O)(=O)N(C)C)cn1)C1CCC1 |
| InChI | InChI=1S/C13H21N3O2S/c1-10(11-5-4-6-11)15-13-8-7-12(9-14-13)19(17,18)16(2)3/h7-11H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | UCRRBMGURMLWSW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |