C11H18N4O2S — CID 103341109
N,N-dimethyl-6-(pyrrolidin-3-ylamino)pyridine-3-sulfonamide (PubChem CID 103341109) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is N,N-dimethyl-6-(pyrrolidin-3-ylamino)pyridine-3-sulfonamide.
| Compound Name | N,N-dimethyl-6-(pyrrolidin-3-ylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103341109 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N,N-dimethyl-6-(pyrrolidin-3-ylamino)pyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC2CCNC2)nc1 |
| InChI | InChI=1S/C11H18N4O2S/c1-15(2)18(16,17)10-3-4-11(13-8-10)14-9-5-6-12-7-9/h3-4,8-9,12H,5-7H2,1-2H3,(H,13,14) |
| InChIKey | ROWDOBXAUNXYIY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |