C12H20N4O2S — CID 103341110
N,N-dimethyl-6-(pyrrolidin-2-ylmethylamino)pyridine-3-sulfonamide (PubChem CID 103341110) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is N,N-dimethyl-6-(pyrrolidin-2-ylmethylamino)pyridine-3-sulfonamide.
| Compound Name | N,N-dimethyl-6-(pyrrolidin-2-ylmethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103341110 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N,N-dimethyl-6-(pyrrolidin-2-ylmethylamino)pyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NCC2CCCN2)nc1 |
| InChI | InChI=1S/C12H20N4O2S/c1-16(2)19(17,18)11-5-6-12(15-9-11)14-8-10-4-3-7-13-10/h5-6,9-10,13H,3-4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | ALSNHXIIGVYBKR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |