C13H21N3O3S — CID 103623850
6-[(4-hydroxycyclohexyl)amino]-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 103623850) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 6-[(4-hydroxycyclohexyl)amino]-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-[(4-hydroxycyclohexyl)amino]-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103623850 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-[(4-hydroxycyclohexyl)amino]-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC2CCC(O)CC2)nc1 |
| InChI | InChI=1S/C13H21N3O3S/c1-16(2)20(18,19)12-7-8-13(14-9-12)15-10-3-5-11(17)6-4-10/h7-11,17H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | KMPDCELYCXIQLW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |