C11H15N3O2S — CID 96664227
N-cyclopropyl-6-(cyclopropylamino)pyridine-3-sulfonamide (PubChem CID 96664227) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is N-cyclopropyl-6-(cyclopropylamino)pyridine-3-sulfonamide.
| Compound Name | N-cyclopropyl-6-(cyclopropylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 96664227 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N-cyclopropyl-6-(cyclopropylamino)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccc(NC2CC2)nc1 |
| InChI | InChI=1S/C11H15N3O2S/c15-17(16,14-9-3-4-9)10-5-6-11(12-7-10)13-8-1-2-8/h5-9,14H,1-4H2,(H,12,13) |
| InChIKey | QHLUHXSHXPTPCW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |