C14H23N3O2S — CID 62149094
6-(ethylamino)-N-(4-methylcyclohexyl)pyridine-3-sulfonamide (PubChem CID 62149094) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 6-(ethylamino)-N-(4-methylcyclohexyl)pyridine-3-sulfonamide.
| Compound Name | 6-(ethylamino)-N-(4-methylcyclohexyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62149094 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 6-(ethylamino)-N-(4-methylcyclohexyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)NC2CCC(C)CC2)cn1 |
| InChI | InChI=1S/C14H23N3O2S/c1-3-15-14-9-8-13(10-16-14)20(18,19)17-12-6-4-11(2)5-7-12/h8-12,17H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | CUGZHDORVUXURU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |