C12H19N3O2S — CID 55071630
N-(2-methylcyclopropyl)-6-(propylamino)pyridine-3-sulfonamide (PubChem CID 55071630) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(2-methylcyclopropyl)-6-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-(2-methylcyclopropyl)-6-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55071630 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(2-methylcyclopropyl)-6-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)NC2CC2C)cn1 |
| InChI | InChI=1S/C12H19N3O2S/c1-3-6-13-12-5-4-10(8-14-12)18(16,17)15-11-7-9(11)2/h4-5,8-9,11,15H,3,6-7H2,1-2H3,(H,13,14) |
| InChIKey | DESVBKKVNIXCPZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |