C13H21N3 — CID 62406978
2-N-(1-cyclohexylethyl)pyridine-2,5-diamine (PubChem CID 62406978) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-N-(1-cyclohexylethyl)pyridine-2,5-diamine.
| Compound Name | 2-N-(1-cyclohexylethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 62406978 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-N-(1-cyclohexylethyl)pyridine-2,5-diamine |
| SMILES | CC(Nc1ccc(N)cn1)C1CCCCC1 |
| InChI | InChI=1S/C13H21N3/c1-10(11-5-3-2-4-6-11)16-13-8-7-12(14)9-15-13/h7-11H,2-6,14H2,1H3,(H,15,16) |
| InChIKey | PCYXPHQODLXACD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |