C15H19N3O2S — CID 829839
6-anilino-N,N-diethylpyridine-3-sulfonamide (PubChem CID 829839) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 6-anilino-N,N-diethylpyridine-3-sulfonamide.
| Compound Name | 6-anilino-N,N-diethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 829839 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 6-anilino-N,N-diethylpyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ccccc2)nc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-3-18(4-2)21(19,20)14-10-11-15(16-12-14)17-13-8-6-5-7-9-13/h5-12H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | RNZILJNZFKQARQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |