C15H20N6O3S — CID 18104092
1-[[5-(diethylsulfamoyl)-2-pyridinyl]amino]-3-pyridin-3-ylurea (PubChem CID 18104092) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-[[5-(diethylsulfamoyl)-2-pyridinyl]amino]-3-pyridin-3-ylurea.
| Compound Name | 1-[[5-(diethylsulfamoyl)-2-pyridinyl]amino]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 18104092 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-[[5-(diethylsulfamoyl)-2-pyridinyl]amino]-3-pyridin-3-ylurea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NNC(=O)Nc2cccnc2)nc1 |
| InChI | InChI=1S/C15H20N6O3S/c1-3-21(4-2)25(23,24)13-7-8-14(17-11-13)19-20-15(22)18-12-6-5-9-16-10-12/h5-11H,3-4H2,1-2H3,(H,17,19)(H2,18,20,22) |
| InChIKey | JNZBGLMUYDRUIK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|