C19H24N4O3S — CID 113009351
4-(diethylsulfamoyl)-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide (PubChem CID 113009351) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113009351 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide |
| SMILES | C=CCNc1ccc(NC(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)cn1 |
| InChI | InChI=1S/C19H24N4O3S/c1-4-13-20-18-12-9-16(14-21-18)22-19(24)15-7-10-17(11-8-15)27(25,26)23(5-2)6-3/h4,7-12,14H,1,5-6,13H2,2-3H3,(H,20,21)(H,22,24) |
| InChIKey | AAFBHSAEXSTNGY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|