C17H19N3O3 — CID 113009330
3,5-dimethoxy-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide (PubChem CID 113009330) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113009330 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3,5-dimethoxy-N-[6-(prop-2-enylamino)-3-pyridinyl]benzamide |
| SMILES | C=CCNc1ccc(NC(=O)c2cc(OC)cc(OC)c2)cn1 |
| InChI | InChI=1S/C17H19N3O3/c1-4-7-18-16-6-5-13(11-19-16)20-17(21)12-8-14(22-2)10-15(9-12)23-3/h4-6,8-11H,1,7H2,2-3H3,(H,18,19)(H,20,21) |
| InChIKey | JWJNJOMJRDAYAX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|