C24H27N3O6 — CID 110179316
N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3,4,5-trimethoxybenzamide (PubChem CID 110179316) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 110179316 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(CNc2ccc(NC(=O)c3cc(OC)c(OC)c(OC)c3)cn2)c(OC)c1 |
| InChI | InChI=1S/C24H27N3O6/c1-29-18-8-6-15(19(12-18)30-2)13-25-22-9-7-17(14-26-22)27-24(28)16-10-20(31-3)23(33-5)21(11-16)32-4/h6-12,14H,13H2,1-5H3,(H,25,26)(H,27,28) |
| InChIKey | WQXXSJDRYPBKIZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |