C18H23N3O4 — CID 110179389
N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3-hydroxybutanamide (PubChem CID 110179389) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3-hydroxybutanamide.
| Compound Name | N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 110179389 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[6-[(2,4-dimethoxyphenyl)methylamino]-3-pyridinyl]-3-hydroxybutanamide |
| SMILES | COc1ccc(CNc2ccc(NC(=O)CC(C)O)cn2)c(OC)c1 |
| InChI | InChI=1S/C18H23N3O4/c1-12(22)8-18(23)21-14-5-7-17(20-11-14)19-10-13-4-6-15(24-2)9-16(13)25-3/h4-7,9,11-12,22H,8,10H2,1-3H3,(H,19,20)(H,21,23) |
| InChIKey | BCQXEMIIZQYNCR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |