C18H24N2O4S — CID 133359877
6-tert-butylsulfonyl-N-[(2,4-dimethoxyphenyl)methyl]pyridin-3-amine (PubChem CID 133359877) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 6-tert-butylsulfonyl-N-[(2,4-dimethoxyphenyl)methyl]pyridin-3-amine.
| Compound Name | 6-tert-butylsulfonyl-N-[(2,4-dimethoxyphenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 133359877 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6-tert-butylsulfonyl-N-[(2,4-dimethoxyphenyl)methyl]pyridin-3-amine |
| SMILES | COc1ccc(CNc2ccc(S(=O)(=O)C(C)(C)C)nc2)c(OC)c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-18(2,3)25(21,22)17-9-7-14(12-20-17)19-11-13-6-8-15(23-4)10-16(13)24-5/h6-10,12,19H,11H2,1-5H3 |
| InChIKey | REOSKLTYARZBEI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |