C14H14BrFN2O2 — CID 104923949
5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropyridin-2-amine (PubChem CID 104923949) has the molecular formula C14H14BrFN2O2 and a molecular weight of 341.18 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropyridin-2-amine.
| Compound Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 104923949 |
| Molecular Formula | C14H14BrFN2O2 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropyridin-2-amine |
| SMILES | COc1ccc(CNc2ncc(Br)cc2F)c(OC)c1 |
| InChI | InChI=1S/C14H14BrFN2O2/c1-19-11-4-3-9(13(6-11)20-2)7-17-14-12(16)5-10(15)8-18-14/h3-6,8H,7H2,1-2H3,(H,17,18) |
| InChIKey | NULGLWMGZZHOQT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |