C13H16BrN5O2 — CID 80906951
5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylpyrimidin-4-amine (PubChem CID 80906951) has the molecular formula C13H16BrN5O2 and a molecular weight of 354.21 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80906951 |
| Molecular Formula | C13H16BrN5O2 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylpyrimidin-4-amine |
| SMILES | COc1ccc(CNc2nc(NN)ncc2Br)c(OC)c1 |
| InChI | InChI=1S/C13H16BrN5O2/c1-20-9-4-3-8(11(5-9)21-2)6-16-12-10(14)7-17-13(18-12)19-15/h3-5,7H,6,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | XFRAXBIARMIYOO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|