C14H16BrN3O2 — CID 103518137
5-bromo-4-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3,4-diamine (PubChem CID 103518137) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-bromo-4-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518137 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 5-bromo-4-N-[(2,4-dimethoxyphenyl)methyl]pyridine-3,4-diamine |
| SMILES | COc1ccc(CNc2c(N)cncc2Br)c(OC)c1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-19-10-4-3-9(13(5-10)20-2)6-18-14-11(15)7-17-8-12(14)16/h3-5,7-8H,6,16H2,1-2H3,(H,17,18) |
| InChIKey | SOKHLMATWXRNGB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |