C14H17ClN4O2 — CID 154666347
6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]pyridine-2,3,4-triamine (PubChem CID 154666347) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]pyridine-2,3,4-triamine.
| Compound Name | 6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]pyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 154666347 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]pyridine-2,3,4-triamine |
| SMILES | COc1ccc(CNc2nc(Cl)cc(N)c2N)c(OC)c1 |
| InChI | InChI=1S/C14H17ClN4O2/c1-20-9-4-3-8(11(5-9)21-2)7-18-14-13(17)10(16)6-12(15)19-14/h3-6H,7,17H2,1-2H3,(H3,16,18,19) |
| InChIKey | ADEZZXFJDFWQLU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|