C22H25ClN4O3 — CID 155034444
6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3,4-triamine (PubChem CID 155034444) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is 6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3,4-triamine.
| Compound Name | 6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 155034444 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 6-chloro-2-N-[(2,4-dimethoxyphenyl)methyl]-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3,4-triamine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)c2nc(Cl)cc(N)c2N)cc1 |
| InChI | InChI=1S/C22H25ClN4O3/c1-28-16-7-4-14(5-8-16)12-27(22-21(25)18(24)11-20(23)26-22)13-15-6-9-17(29-2)10-19(15)30-3/h4-11H,12-13,25H2,1-3H3,(H2,24,26) |
| InChIKey | ILCMFRHUPMUATH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|