C25H23ClN2O2S — CID 138688085
2-[bis[(4-methoxyphenyl)methyl]amino]-3-chloroquinoline-7-thiol (PubChem CID 138688085) has the molecular formula C25H23ClN2O2S and a molecular weight of 450.99 g/mol. Its IUPAC name is 2-[bis[(4-methoxyphenyl)methyl]amino]-3-chloroquinoline-7-thiol.
| Compound Name | 2-[bis[(4-methoxyphenyl)methyl]amino]-3-chloroquinoline-7-thiol |
|---|---|
| PubChem CID | 138688085 |
| Molecular Formula | C25H23ClN2O2S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-[bis[(4-methoxyphenyl)methyl]amino]-3-chloroquinoline-7-thiol |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc3cc(S)ccc3cc2Cl)cc1 |
| InChI | InChI=1S/C25H23ClN2O2S/c1-29-20-8-3-17(4-9-20)15-28(16-18-5-10-21(30-2)11-6-18)25-23(26)13-19-7-12-22(31)14-24(19)27-25/h3-14,31H,15-16H2,1-2H3 |
| InChIKey | IASPXNPMKJMVRK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 34.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|