C23H20BrClF3NO2 — CID 170907615
3-bromo-5-chloro-N,N-bis[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)aniline (PubChem CID 170907615) has the molecular formula C23H20BrClF3NO2 and a molecular weight of 514.77 g/mol. Its IUPAC name is 3-bromo-5-chloro-N,N-bis[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)aniline.
| Compound Name | 3-bromo-5-chloro-N,N-bis[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 170907615 |
| Molecular Formula | C23H20BrClF3NO2 |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | 3-bromo-5-chloro-N,N-bis[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)aniline |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(Cl)c(C(F)(F)F)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H20BrClF3NO2/c1-30-18-7-3-15(4-8-18)13-29(14-16-5-9-19(31-2)10-6-16)17-11-20(24)22(21(25)12-17)23(26,27)28/h3-12H,13-14H2,1-2H3 |
| InChIKey | HMKOZUCGFPIXNQ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |