C24H21BrF5NO2 — CID 171756742
3-bromo-2,6-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-5-methyl-4-(trifluoromethyl)aniline (PubChem CID 171756742) has the molecular formula C24H21BrF5NO2 and a molecular weight of 530.33 g/mol. Its IUPAC name is 3-bromo-2,6-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-5-methyl-4-(trifluoromethyl)aniline.
| Compound Name | 3-bromo-2,6-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-5-methyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 171756742 |
| Molecular Formula | C24H21BrF5NO2 |
| Molecular Weight | 530.33 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | 3-bromo-2,6-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-5-methyl-4-(trifluoromethyl)aniline |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2c(F)c(C)c(C(F)(F)F)c(Br)c2F)cc1 |
| InChI | InChI=1S/C24H21BrF5NO2/c1-14-19(24(28,29)30)20(25)22(27)23(21(14)26)31(12-15-4-8-17(32-2)9-5-15)13-16-6-10-18(33-3)11-7-16/h4-11H,12-13H2,1-3H3 |
| InChIKey | AASAVRAZAWHBCS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.33 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|