C23H21BrF2INO2 — CID 170357152
3-bromo-2,6-difluoro-4-iodo-N,N-bis[(4-methoxyphenyl)methyl]-5-methylaniline (PubChem CID 170357152) has the molecular formula C23H21BrF2INO2 and a molecular weight of 588.23 g/mol. Its IUPAC name is 3-bromo-2,6-difluoro-4-iodo-N,N-bis[(4-methoxyphenyl)methyl]-5-methylaniline.
| Compound Name | 3-bromo-2,6-difluoro-4-iodo-N,N-bis[(4-methoxyphenyl)methyl]-5-methylaniline |
|---|---|
| PubChem CID | 170357152 |
| Molecular Formula | C23H21BrF2INO2 |
| Molecular Weight | 588.23 g/mol |
| Exact Mass | 586.98 |
| IUPAC Name | 3-bromo-2,6-difluoro-4-iodo-N,N-bis[(4-methoxyphenyl)methyl]-5-methylaniline |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2c(F)c(C)c(I)c(Br)c2F)cc1 |
| InChI | InChI=1S/C23H21BrF2INO2/c1-14-20(25)23(21(26)19(24)22(14)27)28(12-15-4-8-17(29-2)9-5-15)13-16-6-10-18(30-3)11-7-16/h4-11H,12-13H2,1-3H3 |
| InChIKey | KRSAVBPMNDEBPI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.23 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|