C25H24BrF2NO3 — CID 170357064
2-[4-[bis[(4-methoxyphenyl)methyl]amino]-2-bromo-3,5-difluoro-6-methylphenyl]acetaldehyde (PubChem CID 170357064) has the molecular formula C25H24BrF2NO3 and a molecular weight of 504.37 g/mol. Its IUPAC name is 2-[4-[bis[(4-methoxyphenyl)methyl]amino]-2-bromo-3,5-difluoro-6-methylphenyl]acetaldehyde.
| Compound Name | 2-[4-[bis[(4-methoxyphenyl)methyl]amino]-2-bromo-3,5-difluoro-6-methylphenyl]acetaldehyde |
|---|---|
| PubChem CID | 170357064 |
| Molecular Formula | C25H24BrF2NO3 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2-[4-[bis[(4-methoxyphenyl)methyl]amino]-2-bromo-3,5-difluoro-6-methylphenyl]acetaldehyde |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2c(F)c(C)c(CC=O)c(Br)c2F)cc1 |
| InChI | InChI=1S/C25H24BrF2NO3/c1-16-21(12-13-30)22(26)24(28)25(23(16)27)29(14-17-4-8-19(31-2)9-5-17)15-18-6-10-20(32-3)11-7-18/h4-11,13H,12,14-15H2,1-3H3 |
| InChIKey | LJHXCUQTPCJCMD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|