C24H25BrFNO2 — CID 170423235
5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3,4-dimethylaniline (PubChem CID 170423235) has the molecular formula C24H25BrFNO2 and a molecular weight of 458.37 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3,4-dimethylaniline.
| Compound Name | 5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 170423235 |
| Molecular Formula | C24H25BrFNO2 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3,4-dimethylaniline |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(Br)c(C)c(C)c2F)cc1 |
| InChI | InChI=1S/C24H25BrFNO2/c1-16-17(2)24(26)23(13-22(16)25)27(14-18-5-9-20(28-3)10-6-18)15-19-7-11-21(29-4)12-8-19/h5-13H,14-15H2,1-4H3 |
| InChIKey | JTSSCDKEIGWEJT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |