C26H27BrFNO3 — CID 170356892
5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-4-(1-methoxyprop-1-en-2-yl)aniline (PubChem CID 170356892) has the molecular formula C26H27BrFNO3 and a molecular weight of 500.41 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-4-(1-methoxyprop-1-en-2-yl)aniline.
| Compound Name | 5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-4-(1-methoxyprop-1-en-2-yl)aniline |
|---|---|
| PubChem CID | 170356892 |
| Molecular Formula | C26H27BrFNO3 |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 5-bromo-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-4-(1-methoxyprop-1-en-2-yl)aniline |
| SMILES | COC=C(C)c1cc(F)c(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)cc1Br |
| InChI | InChI=1S/C26H27BrFNO3/c1-18(17-30-2)23-13-25(28)26(14-24(23)27)29(15-19-5-9-21(31-3)10-6-19)16-20-7-11-22(32-4)12-8-20/h5-14,17H,15-16H2,1-4H3 |
| InChIKey | ICERMVWNIBLSHO-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|