C25H22BrFN2O2 — CID 176695054
6-bromo-7-fluoro-N,N-bis[(4-methoxyphenyl)methyl]isoquinolin-3-amine (PubChem CID 176695054) has the molecular formula C25H22BrFN2O2 and a molecular weight of 481.37 g/mol. Its IUPAC name is 6-bromo-7-fluoro-N,N-bis[(4-methoxyphenyl)methyl]isoquinolin-3-amine.
| Compound Name | 6-bromo-7-fluoro-N,N-bis[(4-methoxyphenyl)methyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 176695054 |
| Molecular Formula | C25H22BrFN2O2 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 6-bromo-7-fluoro-N,N-bis[(4-methoxyphenyl)methyl]isoquinolin-3-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc3cc(Br)c(F)cc3cn2)cc1 |
| InChI | InChI=1S/C25H22BrFN2O2/c1-30-21-7-3-17(4-8-21)15-29(16-18-5-9-22(31-2)10-6-18)25-13-19-11-23(26)24(27)12-20(19)14-28-25/h3-14H,15-16H2,1-2H3 |
| InChIKey | AKZROYOMUFIBMS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |