C17H15BrClN3O — CID 164934740
3-bromo-2-chloro-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine (PubChem CID 164934740) has the molecular formula C17H15BrClN3O and a molecular weight of 392.68 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine.
| Compound Name | 3-bromo-2-chloro-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine |
|---|---|
| PubChem CID | 164934740 |
| Molecular Formula | C17H15BrClN3O |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 3-bromo-2-chloro-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine |
| SMILES | COc1ccc(CN(C)c2cc3nc(Cl)c(Br)cc3cn2)cc1 |
| InChI | InChI=1S/C17H15BrClN3O/c1-22(10-11-3-5-13(23-2)6-4-11)16-8-15-12(9-20-16)7-14(18)17(19)21-15/h3-9H,10H2,1-2H3 |
| InChIKey | DVJPWRNNEZNNSJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|