C23H20ClFN4O — CID 167511897
3-(5-amino-2-chloro-4-fluorophenyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine (PubChem CID 167511897) has the molecular formula C23H20ClFN4O and a molecular weight of 422.89 g/mol. Its IUPAC name is 3-(5-amino-2-chloro-4-fluorophenyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine.
| Compound Name | 3-(5-amino-2-chloro-4-fluorophenyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine |
|---|---|
| PubChem CID | 167511897 |
| Molecular Formula | C23H20ClFN4O |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3-(5-amino-2-chloro-4-fluorophenyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-1,6-naphthyridin-7-amine |
| SMILES | COc1ccc(CN(C)c2cc3ncc(-c4cc(N)c(F)cc4Cl)cc3cn2)cc1 |
| InChI | InChI=1S/C23H20ClFN4O/c1-29(13-14-3-5-17(30-2)6-4-14)23-10-22-16(12-28-23)7-15(11-27-22)18-8-21(26)20(25)9-19(18)24/h3-12H,13,26H2,1-2H3 |
| InChIKey | JSBZHLPXGJTIOT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|