C25H26N4O — CID 167511483
3-(5-amino-2-methylphenyl)-N-ethyl-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine (PubChem CID 167511483) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-(5-amino-2-methylphenyl)-N-ethyl-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine.
| Compound Name | 3-(5-amino-2-methylphenyl)-N-ethyl-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine |
|---|---|
| PubChem CID | 167511483 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-(5-amino-2-methylphenyl)-N-ethyl-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine |
| SMILES | CCN(Cc1ccc(OC)cc1)c1cc2ncc(-c3cc(N)ccc3C)cc2cn1 |
| InChI | InChI=1S/C25H26N4O/c1-4-29(16-18-6-9-22(30-3)10-7-18)25-13-24-20(15-28-25)11-19(14-27-24)23-12-21(26)8-5-17(23)2/h5-15H,4,16,26H2,1-3H3 |
| InChIKey | RVUXSQHCBYFOLG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|