C21H20BrFN2O2 — CID 170041237
5-bromo-4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine (PubChem CID 170041237) has the molecular formula C21H20BrFN2O2 and a molecular weight of 431.31 g/mol. Its IUPAC name is 5-bromo-4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 5-bromo-4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 170041237 |
| Molecular Formula | C21H20BrFN2O2 |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 5-bromo-4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(F)c(Br)cn2)cc1 |
| InChI | InChI=1S/C21H20BrFN2O2/c1-26-17-7-3-15(4-8-17)13-25(21-11-20(23)19(22)12-24-21)14-16-5-9-18(27-2)10-6-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | JGJDWUPKMZVCMO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |